C18H21NO7S — CID 7844415
diethyl 5-amino-3-[(2,5-dimethylfuran-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 7844415) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is diethyl 5-amino-3-[(2,5-dimethylfuran-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-amino-3-[(2,5-dimethylfuran-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7844415 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | diethyl 5-amino-3-[(2,5-dimethylfuran-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1COC(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C18H21NO7S/c1-5-23-17(21)13-12(14(27-15(13)19)18(22)24-6-2)8-25-16(20)11-7-9(3)26-10(11)4/h7H,5-6,8,19H2,1-4H3 |
| InChIKey | GLQSCAHTJQPIBC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|