C18H19ClN2O8S2 — CID 16569614
diethyl 5-amino-3-[(4-chloro-3-sulfamoylbenzoyl)oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 16569614) has the molecular formula C18H19ClN2O8S2 and a molecular weight of 490.94 g/mol. Its IUPAC name is diethyl 5-amino-3-[(4-chloro-3-sulfamoylbenzoyl)oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-amino-3-[(4-chloro-3-sulfamoylbenzoyl)oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 16569614 |
| Molecular Formula | C18H19ClN2O8S2 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | diethyl 5-amino-3-[(4-chloro-3-sulfamoylbenzoyl)oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1COC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C18H19ClN2O8S2/c1-3-27-17(23)13-10(14(30-15(13)20)18(24)28-4-2)8-29-16(22)9-5-6-11(19)12(7-9)31(21,25)26/h5-7H,3-4,8,20H2,1-2H3,(H2,21,25,26) |
| InChIKey | HFVCYCDTBMMLJT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 165.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|