C18H22F2N3O3S+ — CID 9368975
[5-amino-4-ethoxycarbonyl-2-(methylcarbamoyl)thiophen-3-yl]methyl-[(1R)-1-(2,4-difluorophenyl)ethyl]azanium (PubChem CID 9368975) has the molecular formula C18H22F2N3O3S+ and a molecular weight of 398.46 g/mol. Its IUPAC name is [5-amino-4-ethoxycarbonyl-2-(methylcarbamoyl)thiophen-3-yl]methyl-[(1R)-1-(2,4-difluorophenyl)ethyl]azanium.
| Compound Name | [5-amino-4-ethoxycarbonyl-2-(methylcarbamoyl)thiophen-3-yl]methyl-[(1R)-1-(2,4-difluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9368975 |
| Molecular Formula | C18H22F2N3O3S+ |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [5-amino-4-ethoxycarbonyl-2-(methylcarbamoyl)thiophen-3-yl]methyl-[(1R)-1-(2,4-difluorophenyl)ethyl]azanium |
| SMILES | CCOC(=O)c1c(N)sc(C(=O)NC)c1C[NH2+][C@H](C)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H21F2N3O3S/c1-4-26-18(25)14-12(15(17(24)22-3)27-16(14)21)8-23-9(2)11-6-5-10(19)7-13(11)20/h5-7,9,23H,4,8,21H2,1-3H3,(H,22,24)/p+1/t9-/m1/s1 |
| InChIKey | REALBIVEIAPDDB-SECBINFHSA-O |
| XLogP | 1.97 |
| TPSA | 98.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|