C16H25N3O3S — CID 8543423
ethyl 2-amino-5-(methylcarbamoyl)-4-[(4-methylpiperidin-1-yl)methyl]thiophene-3-carboxylate (PubChem CID 8543423) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is ethyl 2-amino-5-(methylcarbamoyl)-4-[(4-methylpiperidin-1-yl)methyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-5-(methylcarbamoyl)-4-[(4-methylpiperidin-1-yl)methyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 8543423 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl 2-amino-5-(methylcarbamoyl)-4-[(4-methylpiperidin-1-yl)methyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(C(=O)NC)c1CN1CCC(C)CC1 |
| InChI | InChI=1S/C16H25N3O3S/c1-4-22-16(21)12-11(9-19-7-5-10(2)6-8-19)13(15(20)18-3)23-14(12)17/h10H,4-9,17H2,1-3H3,(H,18,20) |
| InChIKey | XBJMWBFJBFQUNN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|