C16H26N3O3S+ — CID 8895766
ethyl 2-amino-4-(azepan-1-ium-1-ylmethyl)-5-(methylcarbamoyl)thiophene-3-carboxylate (PubChem CID 8895766) has the molecular formula C16H26N3O3S+ and a molecular weight of 340.47 g/mol. Its IUPAC name is ethyl 2-amino-4-(azepan-1-ium-1-ylmethyl)-5-(methylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-4-(azepan-1-ium-1-ylmethyl)-5-(methylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 8895766 |
| Molecular Formula | C16H26N3O3S+ |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | ethyl 2-amino-4-(azepan-1-ium-1-ylmethyl)-5-(methylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(C(=O)NC)c1C[NH+]1CCCCCC1 |
| InChI | InChI=1S/C16H25N3O3S/c1-3-22-16(21)12-11(10-19-8-6-4-5-7-9-19)13(15(20)18-2)23-14(12)17/h3-10,17H2,1-2H3,(H,18,20)/p+1 |
| InChIKey | PNBDULPZFACJEV-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|