C16H24N3O2S+ — CID 8583550
ethyl 5-amino-3-(azocan-1-ium-1-ylmethyl)-4-cyanothiophene-2-carboxylate (PubChem CID 8583550) has the molecular formula C16H24N3O2S+ and a molecular weight of 322.45 g/mol. Its IUPAC name is ethyl 5-amino-3-(azocan-1-ium-1-ylmethyl)-4-cyanothiophene-2-carboxylate.
| Compound Name | ethyl 5-amino-3-(azocan-1-ium-1-ylmethyl)-4-cyanothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8583550 |
| Molecular Formula | C16H24N3O2S+ |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 5-amino-3-(azocan-1-ium-1-ylmethyl)-4-cyanothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1C[NH+]1CCCCCCC1 |
| InChI | InChI=1S/C16H23N3O2S/c1-2-21-16(20)14-13(12(10-17)15(18)22-14)11-19-8-6-4-3-5-7-9-19/h2-9,11,18H2,1H3/p+1 |
| InChIKey | VQLJOQNYHCGKSK-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |