C17H25N3O2S — CID 9265156
ethyl 5-amino-4-cyano-3-[(cyclooctylamino)methyl]thiophene-2-carboxylate (PubChem CID 9265156) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is ethyl 5-amino-4-cyano-3-[(cyclooctylamino)methyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-amino-4-cyano-3-[(cyclooctylamino)methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 9265156 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | ethyl 5-amino-4-cyano-3-[(cyclooctylamino)methyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1CNC1CCCCCCC1 |
| InChI | InChI=1S/C17H25N3O2S/c1-2-22-17(21)15-14(13(10-18)16(19)23-15)11-20-12-8-6-4-3-5-7-9-12/h12,20H,2-9,11,19H2,1H3 |
| InChIKey | YYNMZTGPXSXOCD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |