C14H19N3O3S — CID 31480940
ethyl 5-amino-4-cyano-3-[(4-hydroxypiperidin-1-yl)methyl]thiophene-2-carboxylate (PubChem CID 31480940) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is ethyl 5-amino-4-cyano-3-[(4-hydroxypiperidin-1-yl)methyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-amino-4-cyano-3-[(4-hydroxypiperidin-1-yl)methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 31480940 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | ethyl 5-amino-4-cyano-3-[(4-hydroxypiperidin-1-yl)methyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1CN1CCC(O)CC1 |
| InChI | InChI=1S/C14H19N3O3S/c1-2-20-14(19)12-11(10(7-15)13(16)21-12)8-17-5-3-9(18)4-6-17/h9,18H,2-6,8,16H2,1H3 |
| InChIKey | BAKCGHQJSVSGPX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |