C16H19FN2OS — CID 114830954
2-amino-N,N-diethyl-5-(2-fluorophenyl)-4-methylthiophene-3-carboxamide (PubChem CID 114830954) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-amino-N,N-diethyl-5-(2-fluorophenyl)-4-methylthiophene-3-carboxamide.
| Compound Name | 2-amino-N,N-diethyl-5-(2-fluorophenyl)-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 114830954 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-amino-N,N-diethyl-5-(2-fluorophenyl)-4-methylthiophene-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1c(N)sc(-c2ccccc2F)c1C |
| InChI | InChI=1S/C16H19FN2OS/c1-4-19(5-2)16(20)13-10(3)14(21-15(13)18)11-8-6-7-9-12(11)17/h6-9H,4-5,18H2,1-3H3 |
| InChIKey | LBSVOHZIGXWBQI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|