C26H23BrN2O4S — CID 19227381
methyl 4-(4-bromophenyl)-2-[[(E)-2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 19227381) has the molecular formula C26H23BrN2O4S and a molecular weight of 539.45 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-2-[[(E)-2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-2-[[(E)-2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19227381 |
| Molecular Formula | C26H23BrN2O4S |
| Molecular Weight | 539.45 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | methyl 4-(4-bromophenyl)-2-[[(E)-2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCCOc1ccc(/C=C(\C#N)C(=O)Nc2sc(C)c(-c3ccc(Br)cc3)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C26H23BrN2O4S/c1-4-13-33-21-11-5-17(6-12-21)14-19(15-28)24(30)29-25-23(26(31)32-3)22(16(2)34-25)18-7-9-20(27)10-8-18/h5-12,14H,4,13H2,1-3H3,(H,29,30)/b19-14+ |
| InChIKey | SPZIPVTUHHLWIZ-XMHGGMMESA-N |
| XLogP | 6.61 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.45 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|