C25H26N2O6S — CID 19175234
dimethyl 2-[[(E)-3-(4-butoxyphenyl)-2-cyanoprop-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3,4-dicarboxylate (PubChem CID 19175234) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is dimethyl 2-[[(E)-3-(4-butoxyphenyl)-2-cyanoprop-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(E)-3-(4-butoxyphenyl)-2-cyanoprop-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 19175234 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | dimethyl 2-[[(E)-3-(4-butoxyphenyl)-2-cyanoprop-2-enoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3,4-dicarboxylate |
| SMILES | CCCCOc1ccc(/C=C(\C#N)C(=O)Nc2sc3c(c2C(=O)OC)C(C(=O)OC)CC3)cc1 |
| InChI | InChI=1S/C25H26N2O6S/c1-4-5-12-33-17-8-6-15(7-9-17)13-16(14-26)22(28)27-23-21(25(30)32-3)20-18(24(29)31-2)10-11-19(20)34-23/h6-9,13,18H,4-5,10-12H2,1-3H3,(H,27,28)/b16-13+ |
| InChIKey | UHKMLXMAKPAHRN-DTQAZKPQSA-N |
| XLogP | 4.46 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|