C23H27N3O5S — CID 3349096
2-methylpropyl 2-[6-(1,3-dioxoisoindol-2-yl)hexanoylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3349096) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-methylpropyl 2-[6-(1,3-dioxoisoindol-2-yl)hexanoylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | 2-methylpropyl 2-[6-(1,3-dioxoisoindol-2-yl)hexanoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3349096 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-methylpropyl 2-[6-(1,3-dioxoisoindol-2-yl)hexanoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(NC(=O)CCCCCN2C(=O)c3ccccc3C2=O)sc1C(=O)OCC(C)C |
| InChI | InChI=1S/C23H27N3O5S/c1-14(2)13-31-22(30)19-15(3)24-23(32-19)25-18(27)11-5-4-8-12-26-20(28)16-9-6-7-10-17(16)21(26)29/h6-7,9-10,14H,4-5,8,11-13H2,1-3H3,(H,24,25,27) |
| InChIKey | SRLHOFVSUDLNPG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|