C7H7N5OS — CID 63107015
4-amino-N-(1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide (PubChem CID 63107015) has the molecular formula C7H7N5OS and a molecular weight of 209.23 g/mol. Its IUPAC name is 4-amino-N-(1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63107015 |
| Molecular Formula | C7H7N5OS |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 4-amino-N-(1,3-thiazol-2-yl)-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cn[nH]c1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C7H7N5OS/c8-4-3-10-12-5(4)6(13)11-7-9-1-2-14-7/h1-3H,8H2,(H,10,12)(H,9,11,13) |
| InChIKey | DOHUAADKTJUHNC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |