C14H11FN2OS — CID 63799848
3-(3-aminoprop-1-ynyl)-N-(3-fluorophenyl)thiophene-2-carboxamide (PubChem CID 63799848) has the molecular formula C14H11FN2OS and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(3-fluorophenyl)thiophene-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(3-fluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63799848 |
| Molecular Formula | C14H11FN2OS |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(3-fluorophenyl)thiophene-2-carboxamide |
| SMILES | NCC#Cc1ccsc1C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H11FN2OS/c15-11-4-1-5-12(9-11)17-14(18)13-10(3-2-7-16)6-8-19-13/h1,4-6,8-9H,7,16H2,(H,17,18) |
| InChIKey | ZYFRQXLIVDLQPU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|