C15H13BrN2O2S — CID 82860765
3-(3-aminoprop-1-ynyl)-N-(4-bromo-3-methoxyphenyl)thiophene-2-carboxamide (PubChem CID 82860765) has the molecular formula C15H13BrN2O2S and a molecular weight of 365.25 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(4-bromo-3-methoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(4-bromo-3-methoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 82860765 |
| Molecular Formula | C15H13BrN2O2S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(4-bromo-3-methoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2sccc2C#CCN)ccc1Br |
| InChI | InChI=1S/C15H13BrN2O2S/c1-20-13-9-11(4-5-12(13)16)18-15(19)14-10(3-2-7-17)6-8-21-14/h4-6,8-9H,7,17H2,1H3,(H,18,19) |
| InChIKey | DLMKOGGKBODDGH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|