C14H13N3OS — CID 55239746
3-(3-aminoprop-1-ynyl)-N-(3-methyl-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 55239746) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(3-methyl-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(3-methyl-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55239746 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(3-methyl-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | Cc1cccnc1NC(=O)c1sccc1C#CCN |
| InChI | InChI=1S/C14H13N3OS/c1-10-4-3-8-16-13(10)17-14(18)12-11(5-2-7-15)6-9-19-12/h3-4,6,8-9H,7,15H2,1H3,(H,16,17,18) |
| InChIKey | QJKXIXSHFMQHDV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|