C16H20FNO3 — CID 114943850
N-(2-ethoxy-2-methylpropyl)-4-fluoro-2-(3-hydroxyprop-1-ynyl)benzamide (PubChem CID 114943850) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is N-(2-ethoxy-2-methylpropyl)-4-fluoro-2-(3-hydroxyprop-1-ynyl)benzamide.
| Compound Name | N-(2-ethoxy-2-methylpropyl)-4-fluoro-2-(3-hydroxyprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 114943850 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-(2-ethoxy-2-methylpropyl)-4-fluoro-2-(3-hydroxyprop-1-ynyl)benzamide |
| SMILES | CCOC(C)(C)CNC(=O)c1ccc(F)cc1C#CCO |
| InChI | InChI=1S/C16H20FNO3/c1-4-21-16(2,3)11-18-15(20)14-8-7-13(17)10-12(14)6-5-9-19/h7-8,10,19H,4,9,11H2,1-3H3,(H,18,20) |
| InChIKey | XNBATAQWVAVKDL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|