C17H22FNO2 — CID 103463889
N-(2,2-dimethylbutyl)-4-fluoro-2-(4-hydroxybut-1-ynyl)benzamide (PubChem CID 103463889) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-4-fluoro-2-(4-hydroxybut-1-ynyl)benzamide.
| Compound Name | N-(2,2-dimethylbutyl)-4-fluoro-2-(4-hydroxybut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 103463889 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-(2,2-dimethylbutyl)-4-fluoro-2-(4-hydroxybut-1-ynyl)benzamide |
| SMILES | CCC(C)(C)CNC(=O)c1ccc(F)cc1C#CCCO |
| InChI | InChI=1S/C17H22FNO2/c1-4-17(2,3)12-19-16(21)15-9-8-14(18)11-13(15)7-5-6-10-20/h8-9,11,20H,4,6,10,12H2,1-3H3,(H,19,21) |
| InChIKey | YBGGRQKMAHNMHR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|