C13H18N2O4S2 — CID 63860807
3-(3-hydroxyprop-1-ynyl)-N-[2-(methanesulfonamido)-2-methylpropyl]thiophene-2-carboxamide (PubChem CID 63860807) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-[2-(methanesulfonamido)-2-methylpropyl]thiophene-2-carboxamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-[2-(methanesulfonamido)-2-methylpropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63860807 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-[2-(methanesulfonamido)-2-methylpropyl]thiophene-2-carboxamide |
| SMILES | CC(C)(CNC(=O)c1sccc1C#CCO)NS(C)(=O)=O |
| InChI | InChI=1S/C13H18N2O4S2/c1-13(2,15-21(3,18)19)9-14-12(17)11-10(5-4-7-16)6-8-20-11/h6,8,15-16H,7,9H2,1-3H3,(H,14,17) |
| InChIKey | LAKOISKOTIAIOE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|