C12H20N2OS — CID 83142073
3-amino-N-(2,3,3-trimethylbutyl)thiophene-2-carboxamide (PubChem CID 83142073) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 3-amino-N-(2,3,3-trimethylbutyl)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-(2,3,3-trimethylbutyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 83142073 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-amino-N-(2,3,3-trimethylbutyl)thiophene-2-carboxamide |
| SMILES | CC(CNC(=O)c1sccc1N)C(C)(C)C |
| InChI | InChI=1S/C12H20N2OS/c1-8(12(2,3)4)7-14-11(15)10-9(13)5-6-16-10/h5-6,8H,7,13H2,1-4H3,(H,14,15) |
| InChIKey | KIGGEYPETLYHFP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |