C9H12N2O4S — CID 107211618
methyl 3-[(3-aminothiophene-2-carbonyl)amino]-2-hydroxypropanoate (PubChem CID 107211618) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is methyl 3-[(3-aminothiophene-2-carbonyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(3-aminothiophene-2-carbonyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 107211618 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | methyl 3-[(3-aminothiophene-2-carbonyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1sccc1N |
| InChI | InChI=1S/C9H12N2O4S/c1-15-9(14)6(12)4-11-8(13)7-5(10)2-3-16-7/h2-3,6,12H,4,10H2,1H3,(H,11,13) |
| InChIKey | OATSZNJNNZWZGE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |