C10H16N2O2S2 — CID 106308533
3-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-2-carboxamide (PubChem CID 106308533) has the molecular formula C10H16N2O2S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 3-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106308533 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-2-carboxamide |
| SMILES | Nc1ccsc1C(=O)NCCSCCCO |
| InChI | InChI=1S/C10H16N2O2S2/c11-8-2-6-16-9(8)10(14)12-3-7-15-5-1-4-13/h2,6,13H,1,3-5,7,11H2,(H,12,14) |
| InChIKey | DIODPDULVATIIC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|