C16H10F7NO2 — CID 146150657
N-[[2-(difluoromethoxy)-5-fluorophenyl]methyl]-2-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 146150657) has the molecular formula C16H10F7NO2 and a molecular weight of 381.25 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-5-fluorophenyl]methyl]-2-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[[2-(difluoromethoxy)-5-fluorophenyl]methyl]-2-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 146150657 |
| Molecular Formula | C16H10F7NO2 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-[[2-(difluoromethoxy)-5-fluorophenyl]methyl]-2-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1cc(F)ccc1OC(F)F)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C16H10F7NO2/c17-10-2-4-13(26-15(19)20)8(5-10)7-24-14(25)11-6-9(16(21,22)23)1-3-12(11)18/h1-6,15H,7H2,(H,24,25) |
| InChIKey | VTJAHGSNAQOEND-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |