C24H19F4NO4 — CID 89092678
2-fluoro-N-[[5-(3-formyl-4-methoxyphenyl)-2-methoxyphenyl]methyl]-4-(trifluoromethyl)benzamide (PubChem CID 89092678) has the molecular formula C24H19F4NO4 and a molecular weight of 461.41 g/mol. Its IUPAC name is 2-fluoro-N-[[5-(3-formyl-4-methoxyphenyl)-2-methoxyphenyl]methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-[[5-(3-formyl-4-methoxyphenyl)-2-methoxyphenyl]methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 89092678 |
| Molecular Formula | C24H19F4NO4 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2-fluoro-N-[[5-(3-formyl-4-methoxyphenyl)-2-methoxyphenyl]methyl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(-c2ccc(OC)c(CNC(=O)c3ccc(C(F)(F)F)cc3F)c2)cc1C=O |
| InChI | InChI=1S/C24H19F4NO4/c1-32-21-7-3-14(15-4-8-22(33-2)17(10-15)13-30)9-16(21)12-29-23(31)19-6-5-18(11-20(19)25)24(26,27)28/h3-11,13H,12H2,1-2H3,(H,29,31) |
| InChIKey | VODDLODXKZDHDP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|