C22H16Cl2FNO3 — CID 89092722
2,4-dichloro-N-[[5-(2-fluoro-3-formylphenyl)-2-methoxyphenyl]methyl]benzamide (PubChem CID 89092722) has the molecular formula C22H16Cl2FNO3 and a molecular weight of 432.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[[5-(2-fluoro-3-formylphenyl)-2-methoxyphenyl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[5-(2-fluoro-3-formylphenyl)-2-methoxyphenyl]methyl]benzamide |
|---|---|
| PubChem CID | 89092722 |
| Molecular Formula | C22H16Cl2FNO3 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2,4-dichloro-N-[[5-(2-fluoro-3-formylphenyl)-2-methoxyphenyl]methyl]benzamide |
| SMILES | COc1ccc(-c2cccc(C=O)c2F)cc1CNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H16Cl2FNO3/c1-29-20-8-5-13(17-4-2-3-14(12-27)21(17)25)9-15(20)11-26-22(28)18-7-6-16(23)10-19(18)24/h2-10,12H,11H2,1H3,(H,26,28) |
| InChIKey | WTGGOCTYMVQPDC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|