C26H23Cl2NO4 — CID 68634431
2-[[3-[3-[[(2,4-dichlorobenzoyl)amino]methyl]-4-methoxyphenyl]phenyl]methylidene]butanoic acid (PubChem CID 68634431) has the molecular formula C26H23Cl2NO4 and a molecular weight of 484.38 g/mol. Its IUPAC name is 2-[[3-[3-[[(2,4-dichlorobenzoyl)amino]methyl]-4-methoxyphenyl]phenyl]methylidene]butanoic acid.
| Compound Name | 2-[[3-[3-[[(2,4-dichlorobenzoyl)amino]methyl]-4-methoxyphenyl]phenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 68634431 |
| Molecular Formula | C26H23Cl2NO4 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-[[3-[3-[[(2,4-dichlorobenzoyl)amino]methyl]-4-methoxyphenyl]phenyl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1cccc(-c2ccc(OC)c(CNC(=O)c3ccc(Cl)cc3Cl)c2)c1)C(=O)O |
| InChI | InChI=1S/C26H23Cl2NO4/c1-3-17(26(31)32)11-16-5-4-6-18(12-16)19-7-10-24(33-2)20(13-19)15-29-25(30)22-9-8-21(27)14-23(22)28/h4-14H,3,15H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | ZBMQMESJCFEANT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|