C25H23ClFNO4 — CID 89092645
2-chloro-N-[[5-(3-fluoro-5-formylphenyl)-2-methoxyphenyl]methyl]-4-propoxybenzamide (PubChem CID 89092645) has the molecular formula C25H23ClFNO4 and a molecular weight of 455.91 g/mol. Its IUPAC name is 2-chloro-N-[[5-(3-fluoro-5-formylphenyl)-2-methoxyphenyl]methyl]-4-propoxybenzamide.
| Compound Name | 2-chloro-N-[[5-(3-fluoro-5-formylphenyl)-2-methoxyphenyl]methyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 89092645 |
| Molecular Formula | C25H23ClFNO4 |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-chloro-N-[[5-(3-fluoro-5-formylphenyl)-2-methoxyphenyl]methyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NCc2cc(-c3cc(F)cc(C=O)c3)ccc2OC)c(Cl)c1 |
| InChI | InChI=1S/C25H23ClFNO4/c1-3-8-32-21-5-6-22(23(26)13-21)25(30)28-14-19-11-17(4-7-24(19)31-2)18-9-16(15-29)10-20(27)12-18/h4-7,9-13,15H,3,8,14H2,1-2H3,(H,28,30) |
| InChIKey | ARNDJDOXLNUOCQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|