C24H22ClNO4 — CID 89092614
2-chloro-N-[[5-(3-formylphenyl)-2-hydroxyphenyl]methyl]-4-propoxybenzamide (PubChem CID 89092614) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is 2-chloro-N-[[5-(3-formylphenyl)-2-hydroxyphenyl]methyl]-4-propoxybenzamide.
| Compound Name | 2-chloro-N-[[5-(3-formylphenyl)-2-hydroxyphenyl]methyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 89092614 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-chloro-N-[[5-(3-formylphenyl)-2-hydroxyphenyl]methyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NCc2cc(-c3cccc(C=O)c3)ccc2O)c(Cl)c1 |
| InChI | InChI=1S/C24H22ClNO4/c1-2-10-30-20-7-8-21(22(25)13-20)24(29)26-14-19-12-18(6-9-23(19)28)17-5-3-4-16(11-17)15-27/h3-9,11-13,15,28H,2,10,14H2,1H3,(H,26,29) |
| InChIKey | IVONGXFCZVCMHP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|