C23H18F4N2O3 — CID 89092657
N-[[2-ethoxy-5-(3-formylphenyl)-3-pyridinyl]methyl]-2-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 89092657) has the molecular formula C23H18F4N2O3 and a molecular weight of 446.40 g/mol. Its IUPAC name is N-[[2-ethoxy-5-(3-formylphenyl)-3-pyridinyl]methyl]-2-fluoro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[[2-ethoxy-5-(3-formylphenyl)-3-pyridinyl]methyl]-2-fluoro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 89092657 |
| Molecular Formula | C23H18F4N2O3 |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[[2-ethoxy-5-(3-formylphenyl)-3-pyridinyl]methyl]-2-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | CCOc1ncc(-c2cccc(C=O)c2)cc1CNC(=O)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C23H18F4N2O3/c1-2-32-22-17(9-16(11-29-22)15-5-3-4-14(8-15)13-30)12-28-21(31)19-7-6-18(10-20(19)24)23(25,26)27/h3-11,13H,2,12H2,1H3,(H,28,31) |
| InChIKey | XGBWNTBDDUIRKX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|