C24H21F4NO5 — CID 46879903
5-[4-butoxy-3-[[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]furan-2-carboxylic acid (PubChem CID 46879903) has the molecular formula C24H21F4NO5 and a molecular weight of 479.43 g/mol. Its IUPAC name is 5-[4-butoxy-3-[[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-butoxy-3-[[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 46879903 |
| Molecular Formula | C24H21F4NO5 |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 5-[4-butoxy-3-[[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]furan-2-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2ccc(C(=O)O)o2)cc1CNC(=O)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C24H21F4NO5/c1-2-3-10-33-19-7-4-14(20-8-9-21(34-20)23(31)32)11-15(19)13-29-22(30)17-6-5-16(12-18(17)25)24(26,27)28/h4-9,11-12H,2-3,10,13H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | BHQYVWUDUZACCC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|