C26H23F4NO4 — CID 73356704
4-[4-butoxy-3-[[[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]-3-fluorobenzoic acid (PubChem CID 73356704) has the molecular formula C26H23F4NO4 and a molecular weight of 489.47 g/mol. Its IUPAC name is 4-[4-butoxy-3-[[[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]-3-fluorobenzoic acid.
| Compound Name | 4-[4-butoxy-3-[[[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 73356704 |
| Molecular Formula | C26H23F4NO4 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 4-[4-butoxy-3-[[[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]-3-fluorobenzoic acid |
| SMILES | CCCCOc1ccc(-c2ccc(C(=O)O)cc2F)cc1CNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H23F4NO4/c1-2-3-12-35-23-11-7-17(21-10-6-18(25(33)34)14-22(21)27)13-19(23)15-31-24(32)16-4-8-20(9-5-16)26(28,29)30/h4-11,13-14H,2-3,12,15H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | UGECCFHLBYCRAR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|