C27H27ClFNO5 — CID 59219230
3-[3-[[(2-chloro-4-propoxybenzoyl)amino]methyl]-4-propoxyphenyl]-2-fluorobenzoic acid (PubChem CID 59219230) has the molecular formula C27H27ClFNO5 and a molecular weight of 499.97 g/mol. Its IUPAC name is 3-[3-[[(2-chloro-4-propoxybenzoyl)amino]methyl]-4-propoxyphenyl]-2-fluorobenzoic acid.
| Compound Name | 3-[3-[[(2-chloro-4-propoxybenzoyl)amino]methyl]-4-propoxyphenyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 59219230 |
| Molecular Formula | C27H27ClFNO5 |
| Molecular Weight | 499.97 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 3-[3-[[(2-chloro-4-propoxybenzoyl)amino]methyl]-4-propoxyphenyl]-2-fluorobenzoic acid |
| SMILES | CCCOc1ccc(C(=O)NCc2cc(-c3cccc(C(=O)O)c3F)ccc2OCCC)c(Cl)c1 |
| InChI | InChI=1S/C27H27ClFNO5/c1-3-12-34-19-9-10-21(23(28)15-19)26(31)30-16-18-14-17(8-11-24(18)35-13-4-2)20-6-5-7-22(25(20)29)27(32)33/h5-11,14-15H,3-4,12-13,16H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | NLMZQTYUNWIOPJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.97 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |