C28H29ClFNO4 — CID 89092796
2-chloro-N-[[5-(4-fluoro-5-formyl-2-methylphenyl)-2-propoxyphenyl]methyl]-4-propoxybenzamide (PubChem CID 89092796) has the molecular formula C28H29ClFNO4 and a molecular weight of 497.99 g/mol. Its IUPAC name is 2-chloro-N-[[5-(4-fluoro-5-formyl-2-methylphenyl)-2-propoxyphenyl]methyl]-4-propoxybenzamide.
| Compound Name | 2-chloro-N-[[5-(4-fluoro-5-formyl-2-methylphenyl)-2-propoxyphenyl]methyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 89092796 |
| Molecular Formula | C28H29ClFNO4 |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 2-chloro-N-[[5-(4-fluoro-5-formyl-2-methylphenyl)-2-propoxyphenyl]methyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NCc2cc(-c3cc(C=O)c(F)cc3C)ccc2OCCC)c(Cl)c1 |
| InChI | InChI=1S/C28H29ClFNO4/c1-4-10-34-22-7-8-23(25(29)15-22)28(33)31-16-20-13-19(6-9-27(20)35-11-5-2)24-14-21(17-32)26(30)12-18(24)3/h6-9,12-15,17H,4-5,10-11,16H2,1-3H3,(H,31,33) |
| InChIKey | BVXMZMRQMWFTNE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|