C20H15Cl2NO4 — CID 89092764
2,4-dichloro-N-[[5-(5-formylfuran-2-yl)-2-methoxyphenyl]methyl]benzamide (PubChem CID 89092764) has the molecular formula C20H15Cl2NO4 and a molecular weight of 404.25 g/mol. Its IUPAC name is 2,4-dichloro-N-[[5-(5-formylfuran-2-yl)-2-methoxyphenyl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[5-(5-formylfuran-2-yl)-2-methoxyphenyl]methyl]benzamide |
|---|---|
| PubChem CID | 89092764 |
| Molecular Formula | C20H15Cl2NO4 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 2,4-dichloro-N-[[5-(5-formylfuran-2-yl)-2-methoxyphenyl]methyl]benzamide |
| SMILES | COc1ccc(-c2ccc(C=O)o2)cc1CNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H15Cl2NO4/c1-26-18-6-2-12(19-7-4-15(11-24)27-19)8-13(18)10-23-20(25)16-5-3-14(21)9-17(16)22/h2-9,11H,10H2,1H3,(H,23,25) |
| InChIKey | ZKKXOAMYDSDSAX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|