C10H8F5NO2 — CID 113248488
2,5-difluoro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide (PubChem CID 113248488) has the molecular formula C10H8F5NO2 and a molecular weight of 269.17 g/mol. Its IUPAC name is 2,5-difluoro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide.
| Compound Name | 2,5-difluoro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 113248488 |
| Molecular Formula | C10H8F5NO2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2,5-difluoro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
| SMILES | O=C(NCC(O)C(F)(F)F)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H8F5NO2/c11-5-1-2-7(12)6(3-5)9(18)16-4-8(17)10(13,14)15/h1-3,8,17H,4H2,(H,16,18) |
| InChIKey | IRYWPCUVIJCYFE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |