C10H14ClNO4S — CID 65372173
5-(tert-butylcarbamoyl)-2-methylfuran-3-sulfonyl chloride (PubChem CID 65372173) has the molecular formula C10H14ClNO4S and a molecular weight of 279.75 g/mol. Its IUPAC name is 5-(tert-butylcarbamoyl)-2-methylfuran-3-sulfonyl chloride.
| Compound Name | 5-(tert-butylcarbamoyl)-2-methylfuran-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65372173 |
| Molecular Formula | C10H14ClNO4S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 5-(tert-butylcarbamoyl)-2-methylfuran-3-sulfonyl chloride |
| SMILES | Cc1oc(C(=O)NC(C)(C)C)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H14ClNO4S/c1-6-8(17(11,14)15)5-7(16-6)9(13)12-10(2,3)4/h5H,1-4H3,(H,12,13) |
| InChIKey | AHYAMQRTMBYHPD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |