C9H11F3N2OS — CID 110834051
N-(3-aminopropyl)-5-(trifluoromethyl)thiophene-3-carboxamide (PubChem CID 110834051) has the molecular formula C9H11F3N2OS and a molecular weight of 252.26 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-(trifluoromethyl)thiophene-3-carboxamide.
| Compound Name | N-(3-aminopropyl)-5-(trifluoromethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 110834051 |
| Molecular Formula | C9H11F3N2OS |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N-(3-aminopropyl)-5-(trifluoromethyl)thiophene-3-carboxamide |
| SMILES | NCCCNC(=O)c1csc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H11F3N2OS/c10-9(11,12)7-4-6(5-16-7)8(15)14-3-1-2-13/h4-5H,1-3,13H2,(H,14,15) |
| InChIKey | QMYDFSYLJIMXJH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|