C13H18NO4+ — CID 6937251
[(2R)-2-(1,3-benzodioxole-5-carbonyloxy)propyl]-dimethylazanium (PubChem CID 6937251) has the molecular formula C13H18NO4+ and a molecular weight of 252.29 g/mol. Its IUPAC name is [(2R)-2-(1,3-benzodioxole-5-carbonyloxy)propyl]-dimethylazanium.
| Compound Name | [(2R)-2-(1,3-benzodioxole-5-carbonyloxy)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 6937251 |
| Molecular Formula | C13H18NO4+ |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | [(2R)-2-(1,3-benzodioxole-5-carbonyloxy)propyl]-dimethylazanium |
| SMILES | C[C@H](C[NH+](C)C)OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H17NO4/c1-9(7-14(2)3)18-13(15)10-4-5-11-12(6-10)17-8-16-11/h4-6,9H,7-8H2,1-3H3/p+1/t9-/m1/s1 |
| InChIKey | NPAGVLZASGSDFL-SECBINFHSA-O |
| XLogP | 0.11 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |