C14H20INO4 — CID 44656442
2-(1,3-benzodioxole-5-carbonyloxy)propyl-trimethylazanium iodide (PubChem CID 44656442) has the molecular formula C14H20INO4 and a molecular weight of 393.22 g/mol. Its IUPAC name is 2-(1,3-benzodioxole-5-carbonyloxy)propyl-trimethylazanium iodide.
| Compound Name | 2-(1,3-benzodioxole-5-carbonyloxy)propyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 44656442 |
| Molecular Formula | C14H20INO4 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-(1,3-benzodioxole-5-carbonyloxy)propyl-trimethylazanium iodide |
| SMILES | CC(C[N+](C)(C)C)OC(=O)c1ccc2c(c1)OCO2.[I-] |
| InChI | InChI=1S/C14H20NO4.HI/c1-10(8-15(2,3)4)19-14(16)11-5-6-12-13(7-11)18-9-17-12;/h5-7,10H,8-9H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IBIGVUXZLBQGLM-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|