C15H16O4 — CID 96542916
[(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate (PubChem CID 96542916) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 96542916 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate |
| SMILES | C#CCC[C@@H](CC)OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H16O4/c1-3-5-6-12(4-2)19-15(16)11-7-8-13-14(9-11)18-10-17-13/h1,7-9,12H,4-6,10H2,2H3/t12-/m1/s1 |
| InChIKey | SNJFEXSHMMIRDB-GFCCVEGCSA-N |
| XLogP | 2.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|