[(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate

C15H16O4 — CID 96542916

IUPAC[(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate
SMILESC#CCC[C@@H](CC)OC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C15H16O4/c1-3-5-6-12(4-2)19-15(16)11-7-8-13-14(9-11)18-10-17-13/h1,7-9,12H,4-6,10H2,2H3/t12-/m1/s1
InChIKeySNJFEXSHMMIRDB-GFCCVEGCSA-N
MW260.29 g/mol
LogP2.76
Rot. Bonds5

About [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate

[(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate (PubChem CID 96542916) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name[(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate
PubChem CID96542916
Molecular FormulaC15H16O4
Molecular Weight260.29 g/mol
Exact Mass260.10
IUPAC Name[(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate
SMILESC#CCC[C@@H](CC)OC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C15H16O4/c1-3-5-6-12(4-2)19-15(16)11-7-8-13-14(9-11)18-10-17-13/h1,7-9,12H,4-6,10H2,2H3/t12-/m1/s1
InChIKeySNJFEXSHMMIRDB-GFCCVEGCSA-N
XLogP2.76
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 52.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate?
The IUPAC name of [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate (CID 96542916) is [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate is C#CCC[C@@H](CC)OC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate?
The InChIKey is SNJFEXSHMMIRDB-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H16O4/c1-3-5-6-12(4-2)19-15(16)11-7-8-13-14(9-11)18-10-17-13/h1,7-9,12H,4-6,10H2,2H3/t12-/m1/s1.
What are the key properties of [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate?
[(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate has a molecular weight of 260.29 g/mol, XLogP of 2.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-hept-6-yn-3-yl] 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 96542916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).