C19H15Cl2NO5 — CID 7204645
2-(2,6-dichlorophenoxy)ethyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 7204645) has the molecular formula C19H15Cl2NO5 and a molecular weight of 408.24 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7204645 |
| Molecular Formula | C19H15Cl2NO5 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCCOc1c(Cl)cccc1Cl)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C19H15Cl2NO5/c20-14-5-2-6-15(21)18(14)26-9-10-27-19(25)12-3-1-4-13(11-12)22-16(23)7-8-17(22)24/h1-6,11H,7-10H2 |
| InChIKey | COVZEBHFVXSZGM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|