C14H12ClN3O5S — CID 24650914
N'-[(2-chloro-3-pyridinyl)sulfonyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 24650914) has the molecular formula C14H12ClN3O5S and a molecular weight of 369.79 g/mol. Its IUPAC name is N'-[(2-chloro-3-pyridinyl)sulfonyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-[(2-chloro-3-pyridinyl)sulfonyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 24650914 |
| Molecular Formula | C14H12ClN3O5S |
| Molecular Weight | 369.79 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N'-[(2-chloro-3-pyridinyl)sulfonyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cccnc1Cl)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H12ClN3O5S/c15-13-12(2-1-5-16-13)24(20,21)18-17-14(19)9-3-4-10-11(8-9)23-7-6-22-10/h1-5,8,18H,6-7H2,(H,17,19) |
| InChIKey | ISHSUQQRORAOCD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.79 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|