C21H17N3O5 — CID 51279505
N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-2-phenoxypyridine-3-carbohydrazide (PubChem CID 51279505) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-2-phenoxypyridine-3-carbohydrazide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-2-phenoxypyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 51279505 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-2-phenoxypyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccnc1Oc1ccccc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H17N3O5/c25-19(14-8-9-17-18(13-14)28-12-11-27-17)23-24-20(26)16-7-4-10-22-21(16)29-15-5-2-1-3-6-15/h1-10,13H,11-12H2,(H,23,25)(H,24,26) |
| InChIKey | QEYJPNCJCGQKTC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|