C23H19F2N3O5 — CID 55464322
N'-[2-[4-(difluoromethoxy)anilino]benzoyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 55464322) has the molecular formula C23H19F2N3O5 and a molecular weight of 455.42 g/mol. Its IUPAC name is N'-[2-[4-(difluoromethoxy)anilino]benzoyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-[2-[4-(difluoromethoxy)anilino]benzoyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 55464322 |
| Molecular Formula | C23H19F2N3O5 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N'-[2-[4-(difluoromethoxy)anilino]benzoyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1Nc1ccc(OC(F)F)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H19F2N3O5/c24-23(25)33-16-8-6-15(7-9-16)26-18-4-2-1-3-17(18)22(30)28-27-21(29)14-5-10-19-20(13-14)32-12-11-31-19/h1-10,13,23,26H,11-12H2,(H,27,29)(H,28,30) |
| InChIKey | MKGDHNKFSVBWQR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|