C29H46N2O4 — CID 139893159
methyl 2-acetamido-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoate (PubChem CID 139893159) has the molecular formula C29H46N2O4 and a molecular weight of 486.70 g/mol. Its IUPAC name is methyl 2-acetamido-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoate.
| Compound Name | methyl 2-acetamido-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 139893159 |
| Molecular Formula | C29H46N2O4 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | methyl 2-acetamido-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)c1ccc(C(=O)OC)c(NC(C)=O)c1 |
| InChI | InChI=1S/C29H46N2O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-30-28(33)25-20-21-26(29(34)35-3)27(23-25)31-24(2)32/h11-12,20-21,23H,4-10,13-19,22H2,1-3H3,(H,30,33)(H,31,32)/b12-11- |
| InChIKey | BDNOGEAPAGFPQC-QXMHVHEDSA-N |
| XLogP | 7.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|