C32H45N3O7S — CID 139893166
2-[(2-nitrophenyl)sulfonylamino]-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoic acid (PubChem CID 139893166) has the molecular formula C32H45N3O7S and a molecular weight of 615.79 g/mol. Its IUPAC name is 2-[(2-nitrophenyl)sulfonylamino]-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoic acid.
| Compound Name | 2-[(2-nitrophenyl)sulfonylamino]-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 139893166 |
| Molecular Formula | C32H45N3O7S |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | 2-[(2-nitrophenyl)sulfonylamino]-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)c1ccc(C(=O)O)c(NS(=O)(=O)c2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H45N3O7S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-24-33-31(36)26-22-23-27(32(37)38)28(25-26)34-43(41,42)30-21-18-17-20-29(30)35(39)40/h9-10,17-18,20-23,25,34H,2-8,11-16,19,24H2,1H3,(H,33,36)(H,37,38)/b10-9- |
| InChIKey | CFMYODWPXPDKRD-KTKRTIGZSA-N |
| XLogP | 7.86 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|