C12H16ClNO4S — CID 43654298
methyl 3-(3-chloropropylsulfonylamino)-4-methylbenzoate (PubChem CID 43654298) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is methyl 3-(3-chloropropylsulfonylamino)-4-methylbenzoate.
| Compound Name | methyl 3-(3-chloropropylsulfonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 43654298 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | methyl 3-(3-chloropropylsulfonylamino)-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NS(=O)(=O)CCCCl)c1 |
| InChI | InChI=1S/C12H16ClNO4S/c1-9-4-5-10(12(15)18-2)8-11(9)14-19(16,17)7-3-6-13/h4-5,8,14H,3,6-7H2,1-2H3 |
| InChIKey | XKRFBKYSXHEQEB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|