C17H21NO5S — CID 8961027
N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 8961027) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 8961027 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCSCc2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C17H21NO5S/c1-20-14-9-12(10-15(21-2)16(14)22-3)17(19)18-6-8-24-11-13-5-4-7-23-13/h4-5,7,9-10H,6,8,11H2,1-3H3,(H,18,19) |
| InChIKey | VUEVQMJJNDXONB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|