C18H21NO4 — CID 18111345
N-[2-(furan-2-yl)ethyl]-3,4-dimethoxy-5-prop-2-enylbenzamide (PubChem CID 18111345) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-3,4-dimethoxy-5-prop-2-enylbenzamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 18111345 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NCCc2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C18H21NO4/c1-4-6-13-11-14(12-16(21-2)17(13)22-3)18(20)19-9-8-15-7-5-10-23-15/h4-5,7,10-12H,1,6,8-9H2,2-3H3,(H,19,20) |
| InChIKey | REYFOOUXVODQJK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|