C22H24ClNO5 — CID 55464623
N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3,4-dimethoxy-5-prop-2-enylbenzamide (PubChem CID 55464623) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3,4-dimethoxy-5-prop-2-enylbenzamide.
| Compound Name | N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55464623 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NCCc2cc(Cl)c3c(c2)OCCO3)cc(OC)c1OC |
| InChI | InChI=1S/C22H24ClNO5/c1-4-5-15-12-16(13-18(26-2)20(15)27-3)22(25)24-7-6-14-10-17(23)21-19(11-14)28-8-9-29-21/h4,10-13H,1,5-9H2,2-3H3,(H,24,25) |
| InChIKey | UOGQPGOJEJOKSC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|